| Identification |
| Name: | Adenosine,N-[(2E)-4-hydroxy-3-methyl-2-buten-1-yl]- |
| Synonyms: | Adenosine,N-(4-hydroxy-3-methyl-2-butenyl)-, (E)- (8CI);Adenosine,N-[(2E)-4-hydroxy-3-methyl-2-butenyl]- (9CI);Zeatin riboside (7CI);6-(4-Hydroxy-3-methyl-trans-2-butenylamino)-9-b-D-ribofuranosylpurine;9-Ribosyl-trans-zeatin;9-b-D-Ribofuranosylzeatin;N6-(4-Hydroxy-3-methylbut-2-trans-enyl)adenosine;N6-(trans-4-Hydroxy-3-methylbut-2-enyl)adenosine;Ribosyl-trans-zeatin;Zeatin 9-riboside;Zeatin 9-b-ribonucleoside;Zeatin ribonucleoside;Zeatin-9-b-D-ribofuranoside;trans-Zeatinriboside;trans-Zeatin-9-riboside; |
| CAS: | 6025-53-2 |
| Molecular Formula: | C15H21N5O5 |
| Molecular Weight: | 351.36 |
| InChI: | InChI=1/C15H21N5O5/c1-8(4-21)2-3-16-13-10-14(18-6-17-13)20(7-19-10)15-12(24)11(23)9(5-22)25-15/h2,6-7,9,11-12,15,21-24H,3-5H2,1H3,(H,16,17,18)/b8-2+/t9-,11-,12-,15-/m1/s1 |
| Molecular Structure: |
 |
| Properties |
| Transport: | OTH |
| Density: | 1.65 g/cm3 |
| Refractive index: | 1.728 |
| Water Solubility: | slightly soluble |
| Solubility: | Soluble Appearance:white to off-white crystalline powder Transport Information: OTH Hazard Symbols:UN NO.
|
| Appearance: | white to off-white crystalline powder |
| Storage Temperature: | −20°C |
| Usage: | A well-known, highly active stimulant of cell divisions in plant tissue cultures |
| Safety Data |
| Hazard Symbols |
|
| |
 |