| Identification | |
| Name: | 1H-Purine-2,6-dione,3,7-dihydro-7-(2-hydroxypropyl)-1,3-dimethyl- |
| CAS: | 603-00-9 |
| EINECS: | 210-028-7 |
| Molecular Formula: | C10H14 N4 O3 |
| Molecular Weight: | 238.24 |
| InChI: | InChI=1/C10H14N4O3/c1-6(15)4-14-5-11-8-7(14)9(16)13(3)10(17)12(8)2/h5-6,15H,4H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 134-136°C |
| Flash Point: | 248.5ºC |
| Boiling Point: | 487.2ºC |
| Density: | 1.46 g/cm3 |
| Refractive index: | 1.664 |
| Specification: | White Solid usageEng:A metabolite of Theophylline Safety Statements:36 36:Wear suitable protective clothing |
| Flash Point: | 248.5ºC |
| Storage Temperature: | Refrigerator |
| Usage: | A metabolite of Theophylline |
| Safety Data | |
 |
|
