| Identification | |
| Name: | Benzene,5-methyl-1,2,3-trinitro- |
| Synonyms: | Toluene,3,4,5-trinitro- (8CI); 3,4,5-Trinitrotoluene |
| CAS: | 603-15-6 |
| Molecular Formula: | C7H5 N3 O6 |
| Molecular Weight: | 227.15 |
| InChI: | InChI=1/C7H5N3O6/c1-4-2-5(8(11)12)7(10(15)16)6(3-4)9(13)14/h2-3H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 242.6°C |
| Boiling Point: | 448.4°C at 760 mmHg |
| Density: | 1.608g/cm3 |
| Refractive index: | 1.637 |
| Specification: |
3,4,5-Trinitrotoluene , its cas register number is 603-15-6. It also can be called Benzene, 5-methyl-1,2,3-trinitro- (9CI) ; Benzene, 5-methyl-1,2,3-trinitro- ; and Toluene, 3,4,5-trinitro- . |
| Flash Point: | 242.6°C |
| Safety Data | |
 |
|
