| Identification | ||
| Name: | 2-Methyl-3-nitroaniline | |
| Synonyms: | 2-Amino-6-nitrotoluene; 3-Nitro-o-toluidine | |
| CAS: | 603-83-8 | |
| EINECS: | 210-059-6 | |
| Molecular Formula: | C7H8N2O2 | |
| Molecular Weight: | 152.15 | |
| InChI: | InChI=1/C7H8N2O2/c1-5-6(8)3-2-4-7(5)9(10)11/h2-4H,8H2,1H3 | |
| Molecular Structure: |  |
|
| Properties | ||
| Transport: | UN 2660 | |
| Density: | 1.269 g/ml | |
| Stability: | Stable under normal temperatures and pressures. | |
| Refractive index: | 1.475 | |
| Water Solubility: | <0.1 g/100 mL at 23 ºC | |
| Appearance: | Yellow. | |
| Specification: |
2-Methyl-3-nitroaniline is incompatible with acids, acid chlorides, acid anhydrides, chloroformates and strong oxidizers. | |
| Packinggroup: | III | |
| HS Code: | 29214300 | |
| Storage Temperature: | Store in a cool, dry, well-ventilated area away from incompatible substances. Keep containers tightly closed. | |
| Safety Data | ||
| Hazard Symbols |
T:Toxic
N:Dangerousfortheenvironment
|
|
 |
||
