| Identification | |
| Name: | DL-2-Pentanol |
| CAS: | 6032-29-7 |
| EINECS: | 227-907-6 |
| Molecular Formula: | C5H12O |
| Molecular Weight: | 88.15 |
| InChI: | InChI=1/C5H12O/c1-3-4-5(2)6/h5-6H,3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1105 |
| Density: | 0.812 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.405-1.407 |
| Solubility: | 16.6 g/ 100 mL (20 ºC) in water |
| Appearance: | colourless liquid |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| HS Code: | 29051500 |
| Storage Temperature: | Flammables area |
| Usage: | 2-Pentanol is used in the production of catalyst systems for dimerization and polymerization, and for the synthesis of methanol from carbon monoxide and hydrogen. It is also used as a solvent for primers containing phosphoric acid and for the extraction of 2-hydroxy-4-methylthiobutyric acid. Secondary pentanols are used in the production of lubricant additives; cleaning agents; defrosting agents; various herbicides; and many fragrances. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
