| Identification | |
| Name: | Ethyl 2-(6-bromoimidazo[1,2-a]pyridin-3-yl)acetate |
| Synonyms: | 2-(6-Bromoimidazo[1,2-a]pyridin-3-yl)acetic acid ethyl ester |
| CAS: | 603311-76-8 |
| Molecular Formula: | C11H11BrN2O2 |
| Molecular Weight: | 283.12 |
| InChI: | InChI=1/C11H11BrN2O2/c1-2-16-11(15)5-9-6-13-10-4-3-8(12)7-14(9)10/h3-4,6-7H,2,5H2,1H3 |
| Molecular Structure: | ![(C11H11BrN2O2) 2-(6-Bromoimidazo[1,2-a]pyridin-3-yl)acetic acid ethyl ester](https://img.guidechem.com/structureimg/603311-76-8.gif) |
| Properties | |
| Density: | 1.54 |
| Refractive index: | 1.622 |
| Specification: |
The Ethyl 2-(6-bromoimidazo[1,2-a]pyridin-3-yl)acetate, with the CAS registry number 603311-76-8, has the systematic name of imidazo[1,2-a]pyridine-3-acetic acid, 6-bromo-, ethyl ester. It belongs to the category of Chiral Chemicals. And the molecular formula of the chemical is C11H11BrN2O2. The characteristics of this chemical are as followings: (1)ACD/LogP: 2.38; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 2.33; (4)ACD/LogD (pH 7.4): 2.37; (5)#H bond acceptors: 4; (6)#H bond donors: 0; (7)#Freely Rotating Bonds: 4; (8)Polar Surface Area: 43.6 Å2; (9)Index of Refraction: 1.622; (10)Molar Refractivity: 64.76 cm3; (11)Molar Volume: 183.6 cm3; (12)Polarizability: 25.67×10-24cm3; (13)Surface Tension: 48.3 dyne/cm; (14)Density: 1.54 g/cm3. Addtionally, the following datas could be converted into the molecular structure: |
| Safety Data | |
 |
|
