| Identification | |
| Name: | Methanesulfinic acid,hydroxy-, monosodium salt, dihydrate (8CI,9CI) |
| Synonyms: | Formaldehydesodium sulfoxylate dihydrate; Methanesulfinic acid, hydroxy-, sodium salt,dihydrate; Sodium formaldehydesulfoxylate dihydrate |
| CAS: | 6035-47-8 |
| EINECS: | 205-739-4 |
| Molecular Formula: | CH3NaO3S?2(H2O) |
| Molecular Weight: | 154.11805 |
| InChI: | InChI=1S/CH3O3S.Na.2H2O/c2-1-5(3)4;;;/h1H2,(H,3,4);;2*1H2/q-1;+1;; |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.8 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Water Solubility: | freely soluble in water |
| Solubility: | freely soluble in water |
| Appearance: | white powder |
| Specification: | white crystalline powder Safety Statements:24/25 24/25:Avoid contact with skin and eyes |
| HS Code: | 28311000 |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Color: | HARD WHITE MASSES |
| Usage: | Industrial bleaching agent. |
| Safety Data | |
 |
|
