| Identification | |
| Name: | Acetic acid, copper(2+)salt, monohydrate (8CI,9CI) |
| Synonyms: | Copper(2+) acetate monohydrate;Copper(II) acetatemonohydrate;copper(2+) acetate hydrate (1:2:1);acetic acid, copper(2+) salt, hydrate (2:1:1); |
| CAS: | 6046-93-1 |
| EINECS: | 205-553-3 |
| Molecular Formula: | Cu(C2H4O2)2.H2O |
| Molecular Weight: | 199.66 |
| InChI: | InChI=1/C2H4O2.Cu.H2O/c1-2(3)4;;/h1H3,(H,3,4);;1H2/q;+2;/p-1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 9106/3077 |
| Melting Point: | 115 oC (dec.) |
| Density: | 1.882 |
| Stability: | Stable. Incompatible with oxidizing agents. |
| Water Solubility: | 72 G/L (20 oC) |
| Appearance: | Dark green crystalline solid |
| Specification: |
? Copper(II) Acetate Monohydrate (CAS NO.6046-93-1), its Synonyms are Aceticacid,Copper(2+)Salt,Monohydrate ; Aceticacidcopper(2+)Salt,Monohydrate ; Copperdiacetatemonohydrate ; Kupfer(Ii)-Acetat-Hydrat ; Verdigris ; Acetic Acid, Copper Salt ; Cupric Acetate ; Cupric Acetate 1-Hydrate . |
| Report: |
Copper and its compounds are on the Community Right-To-Know List. |
| HS Code: | 29152900 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | Used as fungicide and in green pigments, chemical synthesis. |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
N: Dangerous for the environment
|
 |
|
