| Identification | |
| Name: | Ethanone,2-chloro-1-(2,5-difluorophenyl)- |
| Synonyms: | 2-Chloro-1-(2,5-difluorophenyl)ethanone; |
| CAS: | 60468-36-2 |
| Molecular Formula: | C8H5ClF2O |
| Molecular Weight: | 190.57 |
| InChI: | InChI=1/C8H5ClFNO2/c9-7-2-1-3-8(10)6(7)4-5-11(12)13/h1-5H/b5-4- |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.353 g/cm3 |
| Refractive index: | 1.593 |
| Appearance: | White solid |
| Specification: |
The Ethanone,2-chloro-1-(2,5-difluorophenyl)- with the cas number 60468-36-2, is also called 2-chloro-1-(2,5-difluorophenyl)ethanone. It still has other names such as (1)2-Chloro-1-(2,5-difluorophenyl)ethanone ; (2)2',5'-Difluorophenacyl chloride ; (3)2-Chloro-2,5-Difluoroacetophenone ; (4)2-Chloro-2',5'-difluoroacetophenone. It belongs to the following product categories: (1)Aromatic Acetophenones & Derivatives (substituted); (2)Benzene series; (3)Acetophenone series. Physical properties about this chemical are: (1)#H bond acceptors: 1 ; (2)#H bond donors: 0 ; (3)#Freely Rotating Bonds: 2 ; (4)Polar Surface Area: 17.07 Å2 ; (5)Index of Refraction: 1.495 ; (6)Molar Refractivity: 41.11 cm3 ; (7)Molar Volume: 140.7 cm3 ; (8)Polarizability: 16.3 ×10-24cm3 ; (9)Surface Tension: 36.1 dyne/cm ; (10)Density: 1.353 g/cm3 ; (11)Flash Point: 99.3 °C ; (12)Enthalpy of Vaporization: 47.74 kJ/mol ; (13)Boiling Point: 240.5 °C at 760 mmHg ; (14)Vapour Pressure: 0.0378 mmHg at 25°C You can still convert the following datas into molecular structure : |
| Safety Data | |
 |
|
