| Identification | |
| Name: | Octanoic acid,1,1'-[(1S)-1-(hydroxymethyl)-1,2-ethanediyl] ester |
| Synonyms: | Octanoicacid, (1S)-1-(hydroxymethyl)-1,2-ethanediyl ester (9CI);Octanoic acid,1-(hydroxymethyl)-1,2-ethanediyl ester, (S)-;1,2-Dioctanoyl-sn-glycerol;sn-1,2-Dioctanoylglycerol; |
| CAS: | 60514-48-9 |
| Molecular Formula: | C19H36O5 |
| Molecular Weight: | 344.48614 |
| InChI: | InChI=1S/C19H36O5/c1-3-5-7-9-11-13-18(21)23-16-17(15-20)24-19(22)14-12-10-8-6-4-2/h17,20H,3-16H2,1-2H3/t17-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 136.8 ºC |
| Boiling Point: | 429.1 ºC |
| Density: | 0.992 g/cm3 |
| Refractive index: | 1.46 |
| Water Solubility: | DMSO: soluble in water |
| Solubility: | DMSO: soluble in water |
| Appearance: | yellow oil |
| Specification: | Off-White Solid usageEng:Cell permeable lipid shown to mimic the effect of tumor-promoting phorbol diesters on mitogenesis and EGF binding and action in intact cells Safety Statements:23-24/25 23:Do not breathe gas/fumes/vapor/spray (appropriate wording to be specified by the manufacturer) 24/25:Avoid contact with skin and eyes |
| Flash Point: | 136.8 ºC |
| Storage Temperature: | −20°C |
| Color: | yellow |
| Usage: | Cell permeable lipid shown to mimic the effect of tumor-promoting phorbol diesters on mitogenesis and EGF binding and action in intact cells |
| Safety Data | |
 |
|
