| Identification | |
| Name: | Pamabrom |
| Synonyms: | 2-amino-2-methyl-propan-1-ol; 8-bromo-1,3-dimethyl-7H-purine-2,6-dione;2-Amino-2-methylpropanol 8-bromotheophyllinate;Pamabrom [USAN];Midol Teen Formula;8-Bromo-3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione compound with 2-amino-2-methyl-1-propanol (1:1);8-Bromotheophylline compound with 2-amino-2-methyl-1-propanol (1:1);1H-Purine-2,6-dione,8-bromo-3,7-dihydro- 1,3-dimethyl-,compd. with 2-amino-2-methyl-1-propanol (1:1);Bayer Select Menstrual Multi-Symptom;Pamabrom USP; |
| CAS: | 606-04-2 |
| EINECS: | 210-103-4 |
| Molecular Formula: | C11H18BrN5O3 |
| Molecular Weight: | 348.2 |
| InChI: | InChI=1/C7H7BrN4O2.C4H11NO/c1-11-4-3(9-6(8)10-4)5(13)12(2)7(11)14;1-4(2,5)3-6/h1-2H3,(H,9,10);6H,3,5H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Appearance: | COA |
| Specification: | White Solid usageEng:A diuretic used to reduce menstrual pains. |
| Storage Temperature: | Refrigerator |
| Usage: | A diuretic used to reduce menstrual pains. |
| Safety Data | |
 |
|
