| Identification | |
| Name: | 1,3-Indanedione |
| Synonyms: | 1,3-Diketohydrindene;1,3-Indandione;3-hydroxyinden-1-one;1H-indene-1,3(2H)-dione;1H-Indene-1, 3 (2H)-dione;indan-1,3-dione;indene-1,3-dione;1,3-Indanedione 97%; |
| CAS: | 606-23-5 |
| EINECS: | 210-109-7 |
| Molecular Formula: | C9H6O2 |
| Molecular Weight: | 146.14 |
| InChI: | InChI=1/C9H6O2/c10-8-5-9(11)7-4-2-1-3-6(7)8/h1-4H,5H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 133.4°C |
| Boiling Point: | 283 |
| Density: | 1.37 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.696 |
| Solubility: | Soluble |
| Appearance: | Beige to brown powder. |
| Packinggroup: | II; III |
| HS Code: | 29143900 |
| Flash Point: | 133.4°C |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. |
| Safety Data | |
 |
|
