Identification |
Name: | Benzenepropanoic acid, b-phenyl- |
Synonyms: | Propionicacid, 3,3-diphenyl- (6CI,7CI,8CI);Diphenylpropionic acid;NSC 631492;NSC 6797;b-Phenylbenzenepropanoic acid; |
CAS: | 606-83-7 |
EINECS: | 210-125-4 |
Molecular Formula: | C15H14O2 |
Molecular Weight: | 226.27 |
InChI: | InChI=1/C15H14O2/c16-15(17)11-14(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10,14H,11H2,(H,16,17) |
Molecular Structure: |
 |
Properties |
Boiling Point: | 365 |
Density: | 1.147 g/cm3 |
Stability: | Stable under normal temperatures and pressures. |
Water Solubility: | slightly soluble |
Solubility: | slightly soluble |
Appearance: | White to light yellow solid. |
Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
Safety Data |
Hazard Symbols |
Xi:Irritant
|
|
 |