| Identification |
| Name: | Benzenepropanoic acid, b-phenyl- |
| Synonyms: | Propionicacid, 3,3-diphenyl- (6CI,7CI,8CI);Diphenylpropionic acid;NSC 631492;NSC 6797;b-Phenylbenzenepropanoic acid; |
| CAS: | 606-83-7 |
| EINECS: | 210-125-4 |
| Molecular Formula: | C15H14O2 |
| Molecular Weight: | 226.27 |
| InChI: | InChI=1/C15H14O2/c16-15(17)11-14(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10,14H,11H2,(H,16,17) |
| Molecular Structure: |
 |
| Properties |
| Boiling Point: | 365 |
| Density: | 1.147 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Water Solubility: | slightly soluble |
| Solubility: | slightly soluble |
| Appearance: | White to light yellow solid. |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
