| Identification | |
| Name: | Vigabatrin |
| Synonyms: | 4-Amino-5-hexenoic acid |
| CAS: | 60643-86-9 |
| Molecular Formula: | C6H11NO2 |
| Molecular Weight: | 129.16 |
| InChI: | InChI=1/C6H11NO2/c1-2-5(7)3-4-6(8)9/h2,5H,1,3-4,7H2,(H,8,9) |
| Molecular Structure: |  |
| Properties | |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Biological Activity: | Selective GABA-T inhibitor. Anticonvulsant. |
| Safety Data | |
 |
|
