Identification |
Name: | Benzonitrile,3-amino-4-methyl- |
Synonyms: | p-Tolunitrile,3-amino- (6CI); 2-Methyl-5-cyanoaniline; 3-Amino-4-methylbenzonitrile;4-Cyano-2-aminotoluene; 5-Cyano-2-methylaniline |
CAS: | 60710-80-7 |
Molecular Formula: | C8H8 N2 |
Molecular Weight: | 132.16 |
InChI: | InChI=1/C8H8N2/c1-6-2-3-7(5-9)4-8(6)10/h2-4H,10H2,1H3 |
Molecular Structure: |
|
Properties |
Transport: | 3276 |
Flash Point: | 142.987°C |
Boiling Point: | 312.817°C at 760 mmHg |
Density: | 1.105g/cm3 |
Refractive index: | 1.576 |
Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36:Wear suitable protective clothing |
Flash Point: | 142.987°C |
Safety Data |
|
|