| Identification | |
| Name: | Benzene,4-(chloromethyl)-1-methoxy-2-methyl- |
| Synonyms: | Anisole,4-(chloromethyl)-2-methyl- (6CI,7CI); 2-Methyl-4-(chloromethyl)anisole;3-Methyl-4-methoxybenzyl chloride; 4-(Chloromethyl)-1-methoxy-2-methylbenzene;4-Methoxy-3-methylbenzyl chloride |
| CAS: | 60736-71-2 |
| Molecular Formula: | C9H11ClO |
| Molecular Weight: | 170.63 |
| InChI: | InChI=1/C9H11ClO/c1-7-5-8(6-10)3-4-9(7)11-2/h3-5H,6H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN1760 |
| Flash Point: | 104.5°C |
| Boiling Point: | 143°C 25mm |
| Density: | 1,11 g/cm3 |
| Refractive index: | 1.515 |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Packinggroup: | III |
| Flash Point: | 104.5°C |
| Safety Data | |
 |
|
