| Identification |
| Name: | 1H-Pyrazino[3,2,1-jk]carbazole,2,3,3a,4,5,6-hexahydro-8-methyl- |
| Synonyms: | Pirlindole |
| CAS: | 60762-57-4 |
| Molecular Formula: | C15H18 N2 |
| Molecular Weight: | 226.31682 |
| InChI: | InChI=1S/C15H18N2/c1-10-5-6-14-12(9-10)11-3-2-4-13-15(11)17(14)8-7-16-13/h5-6,9,13,16H,2-4,7-8H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.29 g/cm3 |
| Water Solubility: | Soluble to 50 mM in water |
| Solubility: | Soluble to 50 mM in water |
| Appearance: | WHITE SOLID |
| Biological Activity: | A highly selective reversible inhibitor of monoamine oxidase type A. |
| Storage Temperature: | Store at RT |
| Safety Data |
| |
 |
