Identification |
Name: | 5-Methoxytryptamine |
Synonyms: | Indole,3-(2-aminoethyl)-5-methoxy- (6CI,8CI);2-(5-Methoxyindol-3-yl)ethylamine;2-[5-(Methyloxy)-1H-indol-3-yl]ethanamine;3-(2-Aminoethyl)-5-methoxyindole;5-MOT;5-Methoxy-1H-indole-3-ethanamine;Deacetylmelatonin;Methoxytryptamine;NSC 56422;[2-(5-Methoxy-1H-indol-3-yl)ethyl]amine; |
CAS: | 608-07-1 |
EINECS: | 210-153-7 |
Molecular Formula: | C11H14N2O |
Molecular Weight: | 190.24 |
InChI: | InChI=1/C11H14N2O/c1-14-9-2-3-11-10(6-9)8(4-5-12)7-13-11/h2-3,6-7,13H,4-5,12H2,1H3 |
Molecular Structure: |
|
Properties |
Flash Point: | 184 |
Boiling Point: | 380 |
Stability: | Stable at normal temperatures and pressures. |
Solubility: | Very soluble |
Appearance: | White to tan crystalline powder |
Flash Point: | 184 |
Storage Temperature: | 2-8°C |
Color: | white |
Usage: | Serotonin derivative proposed as potentiator for hypnotics and sedatives. |
Safety Data |
Hazard Symbols |
Xn:Harmful
|
|
|