| Identification | |
| Name: | 6-(2-Carboxyethylthio)purine |
| Synonyms: | NSC22242;TCMDC-125870;3-(7H-Purin-6-ylthio)propionic acid;Propionic acid, 3-(purin-6-ylthio)-;6-(2-Carboxyethylthio)purine;NSC 22242;NSC-22242;608-10-6;BRN 0616853;3-(7H-purin-6-ylsulfanyl)propanoic acid;AI3-50257;Propanoic acid, 3-(1H-purin-6-ylthio)-;AC1Q5WGO;ChemDiv1_000438;AC1L2B3V;NCIStruc1_000366;NCIStruc2_000613;Oprea1_150321;CHEMBL529139;HMS588D20;MolPort-002-325-895;NCI22242;AR-1L5897;CCG-37955;NCGC00013282;STK364956;3-(9H-purin-6-ylthio)propanoic acid;AKOS000196983;AKOS003573595;WLN: T56 BM DN FN HNJ IS2VQ;NCGC00013282-02;NCGC00096401-01;3-(9H-purin-6-ylsulfanyl)propanoic acid;NCI60_001840;LS-124848;ST50564694;Propanoic acid, 3-(1H-purin-6-ylthio)- (9CI) |
| CAS: | 608-10-6 |
| Molecular Formula: | C8H8N4O2S |
| Molecular Weight: | 224.2397 |
| InChI: | InChI=1/C8H8N4O2S/c13-5(14)1-2-15-8-6-7(10-3-9-6)11-4-12-8/h3-4,6H,1-2H2,(H,13,14) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 221.1°C |
| Boiling Point: | 442°C at 760 mmHg |
| Density: | 1.69g/cm3 |
| Refractive index: | 1.79 |
| Specification: |
6-(2-Carboxyethylthio)purine , its cas register number is 608-10-6. It also can be called 3-(7H-Purin-6-ylthio)propionic acid ; Propionic acid, 3-(purin-6-ylthio)- ; and Propanoic acid, 3-(1H-purin-6-ylthio)- (9CI) . |
| Flash Point: | 221.1°C |
| Safety Data | |
| Hazard Symbols | |
 |
|
