| Identification | |
| Name: | 2-METHYLRESORCINOL |
| Synonyms: | 1,3-Dihydroxy-2-methylbenzene; 2,6-Dihydroxy-1-methylbenzene; 2-methyl-1,3-dihydroxybenzene; 2-methyl-3-benzenediol; 2-Methylresorcin; 2-methyl-resorcino; 3-Benzenediol,2-methyl-1; Resorcinol, 2-methyl-; 2,6-Dihydroxy Toluene; 2-Methyl-1,3-benzenediol; Methylresorcinoltech; gamma-orcinol; 2-Methyl resorcinol; Toluene-2,6-diol; LABOTEST-BB LT00053049; JAROCOL 2MR; 2,6-DIHYDROXYTOLUENE |
| CAS: | 608-25-3 |
| EINECS: | 210-155-8 |
| Molecular Formula: | C7H8O2 |
| Molecular Weight: | 124.14 |
| InChI: | InChI=1/C7H8O2/c1-5-6(8)3-2-4-7(5)9/h2-4,8-9H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 6.1/PG 3 |
| Flash Point: | 282.1 oC at 760 mmHg |
| Density: | 1.21 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.594 |
| Solubility: | Slightly soluble |
| Appearance: | white to off-white crystal |
| Specification: |
? 2-Methylresorcinol (CAS NO.608-25-3), its Synonyms are 1,3-Benzenediol, 2-methyl- ; 2-Methyl-1,3-benzenediol ; 1,3-Dihydroxy-2-methylbenzene ; 2,6-Dihydroxytoluene ; 2-Methyl-1,3-dihydroxybenzene ; 2-Methylresorcin . It is white to off-white crystal powder. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| HS Code: | 29072900 |
| Flash Point: | 282.1 oC at 760 mmHg |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
