| Identification |
| Name: | 4-Piperidinecarbonitrile,4-hydroxy-1-(phenylmethyl)- |
| Synonyms: | Isonipecotonitrile, 1-benzyl-4-hydroxy- (7CI,8CI);1-Benzyl-4-hydroxypiperidin-4-carbonitrile;1-Benzyl-4-hydroxypiperidine-4-carbonitrile; |
| CAS: | 6094-60-6 |
| EINECS: | 228-043-2 |
| Molecular Formula: | C13H16N2O |
| Molecular Weight: | 216.28 |
| InChI: | InChI=1/C13H16N2O/c14-11-13(16)6-8-15(9-7-13)10-12-4-2-1-3-5-12/h1-5,16H,6-10H2 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 3276 |
| Flash Point: | 195.4°C |
| Boiling Point: | 399.5°C at 760 mmHg |
| Density: | 1.17g/cm3 |
| Refractive index: | 1.592 |
| Appearance: | yellow to beige crystalline powder and chunks |
| Packinggroup: | III |
| Flash Point: | 195.4°C |
| Safety Data |
| |
 |
