Identification |
Name: | Benzoic acid,methyl[4-(2-phenyldiazenyl)phenyl]azanyl ester |
Synonyms: | Benzenamine,N-(benzoyloxy)-N-methyl-4-(phenylazo)- (9CI); Hydroxylamine,O-benzoyl-N-methyl-N-[p-(phenylazo)phenyl]- (7CI,8CI);4-[N-(Benzoyloxy)-N-methylamino]azobenzene;N-Benzoyloxy-N-methyl-4-aminoazobenzene |
CAS: | 6098-46-0 |
Molecular Formula: | C20H17 N3 O2 |
Molecular Weight: | 331.40 |
InChI: | InChI=1/C20H17N3O2/c1-23(25-20(24)16-8-4-2-5-9-16)19-14-12-18(13-15-19)22-21-17-10-6-3-7-11-17/h2-15H,1H3/b22-21+ |
Molecular Structure: |
|
Properties |
Flash Point: | 248.4°C |
Boiling Point: | 487.1°C at 760 mmHg |
Density: | 1.13g/cm3 |
Refractive index: | 1.594 |
Specification: |
N-Benzoyloxy-N-methyl-4-aminoazobenzene (CAS NO.6098-46-0) is aslo named as BRN 1844284 ; Benzoyloxy-MAB ; CCRIS 803 ; Hydroxylamine, O-benzoyl-N-methyl-N-(p-(phenylazo)phenyl)- ; N-(Benzoyloxy)-N-methyl-4-(phenylazo)benzenamine ; O-Benzoyl-N-methyl-N-(p-(phenylazo)phenyl)hydroxylamine ; Benzenamine, N-(benzoyloxy)-N-methyl-4-(phenylazo)- (9CI) . N-Benzoyloxy-N-methyl-4-aminoazobenzene (CAS NO.6098-46-0) is toxic. It is flammable. It will produce toxic nitrogen oxide fumes when buring. So the storage environment should be ventilate, low-temperature and dry.
|
Report: |
EPA Genetic Toxicology Program.
|
Flash Point: | 248.4°C |
Safety Data |
|
|