Identification |
Name: | Propanamide,N-[4-(methoxymethyl)-1-(phenylmethyl)-4-piperidinyl]-N-phenyl- |
Synonyms: | 1-Benzyl-4-[N-(1-oxopropyl)-N-phenylamino]-4-methoxymethylpiperidine;N-[1-Benzyl-4-(methoxymethyl)piperidin-4-yl]-N-phenylpropionamide |
CAS: | 61086-12-2 |
EINECS: | 262-596-0 |
Molecular Formula: | C23H30 N2 O2 |
Molecular Weight: | 366.4965 |
InChI: | InChI=1/C23H30N2O2/c1-3-22(26)25(21-12-8-5-9-13-21)23(19-27-2)14-16-24(17-15-23)18-20-10-6-4-7-11-20/h4-13H,3,14-19H2,1-2H3 |
Molecular Structure: |
|
Properties |
Flash Point: | 240.6°C |
Boiling Point: | 474.2°C at 760 mmHg |
Density: | 1.104g/cm3 |
Refractive index: | 1.577 |
Flash Point: | 240.6°C |
Usage: | An intermediate in the preparation of Alfentanil and Sufentanil Citrate |
Safety Data |
|
|