| Identification | |
| Name: | Methyl 2-furoate |
| Synonyms: | Furan-2-carboxylic acid methyl ester; 2-Furoic acid methyl ester; Methyl furan-2-carboxylate; Methyl pyromucate |
| CAS: | 611-13-2 |
| EINECS: | 210-254-6 |
| Molecular Formula: | C6H6O3 |
| Molecular Weight: | 126.11 |
| InChI: | InChI=1/C6H6O3/c1-8-6(7)5-3-2-4-9-5/h2-4H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2810 6.1/PG 3 |
| Melting Point: | 36 |
| Density: | 1.176 |
| Stability: | No data. |
| Refractive index: | 1.483-1.489 |
| Water Solubility: | slightly soluble |
| Solubility: | slightly soluble in water |
| Appearance: | Colorless to light yellow liquid |
| Specification: |
Methyl furoate (CAS NO.611-13-2), its Synonyms are 2-(Methoxycarbonyl)furan ; 2-Furancarboxylic acid, methyl ester ; 2-Furoic acid, methyl ester ; Methyl 2-furancarboxylate ; Methyl 2-furoate ; Methyl 2-furylcarboxylate ; Methyl pyromucate ; Pyromucic acid methyl ester . |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| HS Code: | 29321900 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Lachrymatory |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
