| Identification | |
| Name: | 4-Hydroxyquinoline |
| Synonyms: | Quinoline, 4-hydroxy-;4-Quinolinol;4-Hydroxy Quinoline;Kynurine;Quinolin-4-ol;4-Quinolinol (8CI,9CI); |
| CAS: | 611-36-9 |
| EINECS: | 210-268-2 |
| Molecular Formula: | C9H7NO |
| Molecular Weight: | 145.16 |
| InChI: | InChI=1/C9H7NO/c11-9-5-6-10-8-4-2-1-3-7(8)9/h1-6H,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.188 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.595 |
| Solubility: | soluble in alcohol, slightly soluble in water |
| Appearance: | light yellow and off-white crystal powder |
| Specification: |
?4-Hydroxyquinoline (CAS NO.611-36-9) is also named as BRN 1524969 ; CCRIS 4329 ; Kynurine ; NSC 3183 ; Quinoline, 4-hydroxy- .?4-Hydroxyquinoline (CAS NO.611-36-9) is light beige to yellowish crystal powder or needles. |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
