| Identification |
| Name: | 1-Propanone,2-methyl-1-phenyl- |
| Synonyms: | Isobutyrophenone(6CI,8CI);1-Phenyl-2-methyl-1-propanone;2-Methyl-1-phenyl-1-propanone;2-Methyl-1-phenylpropanone;2-Methylpropiophenone;Isopropyl phenyl ketone;NSC6552;Phenyl isopropyl ketone;a-Methylpropiophenone; |
| CAS: | 611-70-1 |
| EINECS: | 210-275-0 |
| Molecular Formula: | C10H12O |
| Molecular Weight: | 148.2 |
| InChI: | InChI=1/C10H12O/c1-8(2)10(11)9-6-4-3-5-7-9/h3-8H,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 0.988 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.5162-1.5182 |
| Water Solubility: | immiscible |
| Solubility: | immiscible |
| Appearance: | Clear liquid |
| Packinggroup: | I; II; III |
| HS Code: | 29143900 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
