| Identification | |
| Name: | 2-Nitrobenzonitrile |
| Synonyms: | - |
| CAS: | 612-24-8 |
| EINECS: | 210-301-0 |
| Molecular Formula: | C7H4N2O2 |
| Molecular Weight: | 148.12 |
| InChI: | InChI=1/C7H4N2O2/c8-5-6-3-1-2-4-7(6)9(10)11/h1-4H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3276 |
| Density: | 16516 |
| Refractive index: | 1.579 |
| Specification: |
O-Nitrobenzonitrile (CAS NO.612-24-8) is a yellow crystalline powder. |
| Report: |
Cyanide and its compounds are on the Community Right-To-Know List. EPA Genetic Toxicology Program. |
| Packinggroup: | III |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
