| Identification | |
| Name: | Benzoic acid,2-[(carboxymethyl)amino]- |
| Synonyms: | Anthranilicacid, N-(carboxymethyl)- (6CI,7CI,8CI);N-(2-Carboxyphenyl)glycine;N-(Carboxymethyl)anthranilic acid;NSC 80600; |
| CAS: | 612-42-0 |
| EINECS: | 210-311-5 |
| Molecular Formula: | C9H9NO4 |
| Molecular Weight: | 195.17206 |
| InChI: | InChI=1S/C9H9NO4/c11-8(12)5-10-7-4-2-1-3-6(7)9(13)14/h1-4,10H,5H2,(H,11,12)(H,13,14) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.472 g/cm3 |
| Refractive index: | 1.66 |
| Water Solubility: | insoluble in water |
| Solubility: | insoluble in water |
| Appearance: | light yellow to yellow Crystalline powder |
| Specification: | light yellow to yellow crystalline powder Safety Statements:26-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
