| Identification | ||
| Name: | 7-Methylquinoline | |
| Synonyms: | 7-Methylquinoline;NSC 65665; m-Toluquinoline | |
| CAS: | 612-60-2 | |
| EINECS: | 210-316-2 | |
| Molecular Formula: | C10H9N | |
| Molecular Weight: | 143.19 | |
| InChI: | InChI=1/C10H9N/c1-8-4-5-9-3-2-6-11-10(9)7-8/h2-7H,1H3 | |
| Molecular Structure: |  |
|
| Properties | ||
| Transport: | 61848 | |
| Flash Point: | 110 C (closed cup) | |
| Density: | 1.061 | |
| Stability: | Stable. Incompatible with strong oxidizing agents, strong acids. May be light sensitive. | |
| Refractive index: | 1.6068 (20.8 C) | |
| Water Solubility: | <0.1 g/100 mL at 20 ºC | |
| Solubility: | <0.1 g/100 mL at 20 ºC in water | |
| Appearance: | white to light yellow crystal powder | |
| Specification: | white to light yellow crystal powder Safety Statements:26-39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 39:Wear eye/face protection | |
| Packinggroup: | I; II; III | |
| Flash Point: | 110 C (closed cup) | |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. | |
| Safety Data | ||
| Hazard Symbols |
Xi:Irritant
|
|
 |
||
