| Identification | |
| Name: | Quinoline, 2-phenyl- |
| Synonyms: | 2-Phenylquinoline;NSC 118137; a-Phenylquinoline |
| CAS: | 612-96-4 |
| EINECS: | 210-326-7 |
| Molecular Formula: | C15H11 N |
| Molecular Weight: | 205.25 |
| InChI: | InChI=1/C15H11N/c1-2-6-12(7-3-1)15-11-10-13-8-4-5-9-14(13)16-15/h1-11H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 82-84 oC |
| Flash Point: | 159 |
| Boiling Point: | 363 oC |
| Density: | 1.127g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.654 |
| Water Solubility: | SLIGHTLY SOLUBLE |
| Solubility: | SLIGHTLY SOLUBLE |
| Appearance: | White to pale yellow powder. |
| Specification: |
2-Phenylquinoline , its cas register number is 612-96-4. It also can be called Quinoline, 2-phenyl- .It is a white to light yellow crystalline powder. |
| Flash Point: | 159 |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
