| Identification | |
| Name: | 5H-Dibenz[b,f]azepine-2,4,6,8-d4-5-propanamine,10,11-dihydro-N,N-dimethyl-, monohydrochloride (9CI) |
| Synonyms: | IMIPRAMINE-2,4,6,8-D4 HCL;IMIPRAMINE-2,4,6,8-D4 HYDROCHLORIDE;10,11-Dihydro-N,N-dimethyl-5H-dibenz[b,f]azepine-5-propanamine-d4 Hydrochloride;Chrytemin-d4;G-22355-d4;Imiprin-d4;Tofranil-d4 |
| CAS: | 61361-33-9 |
| Molecular Formula: | C19H20 D4 N2 . Cl H |
| Molecular Weight: | 320.89 |
| InChI: | InChI=1/C19H24N2.ClH/c1-20(2)14-7-15-21-18-10-5-3-8-16(18)12-13-17-9-4-6-11-19(17)21;/h3-6,8-11H,7,12-15H2,1-2H3;1H/i3D,4D,10D,11D; |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 174-1750C |
| Specification: | Crystalline Solid usageEng:Tricyclic antidepressant; inhibits the serotonin and norepinephrine transporters. Has little effect on the dopamine transporter |
| Usage: | Tricyclic antidepressant; inhibits the serotonin and norepinephrine transporters. Has little effect on the dopamine transporter |
| Safety Data | |
 |
|
