| Identification | |
| Name: | Benzenamine,N-methyl-N-nitroso- |
| Synonyms: | Aniline,N-methyl-N-nitroso- (6CI,8CI); Methylphenylnitrosamine;Methylphenylnitrosoamine; N-Methyl-N-nitrosoaniline; N-Methyl-N-phenylnitrosamine;N-Methyl-N-phenylnitrosoamine; N-Nitroso-N-methylaniline;N-Nitroso-N-methylphenylamine; N-methyl-N-nitrosobenzenamine; NSC 137;Nitrosomethylphenylamine; Phenylmethylnitrosamine |
| CAS: | 614-00-6 |
| EINECS: | 210-366-5 |
| Molecular Formula: | C7H8 N2 O |
| Molecular Weight: | 136.17 |
| InChI: | InChI=1/C7H8N2O/c1-9(8-10)7-5-3-2-4-6-7/h2-6H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2810 |
| Melting Point: | 13°C |
| Flash Point: | 13 °C |
| Boiling Point: | 128 °C / 19mmHg |
| Density: | 1,13 g/cm3 |
| Refractive index: | 1.534 |
| Solubility: | Insoluble in water; soluble in ethanol and ethyl ether |
| Specification: |
N-Methyl-N-nitrosobenzenamine ,its cas register number is 614-00-6. It also can be called Methylphenylnitrosamine ; N-Nitroso-N-methylaniline ; N-Nitrosomethylphenylamine ;and Phenylmethylnitrosamine . |
| Report: |
Reported in EPA TSCA Inventory. EPA Genetic Toxicology Program. |
| Packinggroup: | III |
| Flash Point: | 13 °C |
| Color: | YELLOW CRYSTALS |
| Safety Data | |
 |
|
