| Identification | |
| Name: | 3-Pyridinecarboxylicacid, ethyl ester |
| Synonyms: | Nicotinicacid, ethyl ester (6CI,8CI);3-(Ethoxycarbonyl)pyridine;3-Carbethoxypyridine;Ethyl 3-pyridinecarboxylate;Ethyl nicotinate;Ignicut;Ignocut;Mucotherm;Nicaethan;Nikethan;Nikithan;b-Pyridinecarboxylic acid ethyl ester; |
| CAS: | 614-18-6 |
| EINECS: | 210-370-7 |
| Molecular Formula: | C8H9NO2 |
| Molecular Weight: | 151.16 |
| InChI: | InChI=1/C8H9NO2/c1-2-11-8(10)7-4-3-5-9-6-7/h3-6H,2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.107 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.5019-1.504 |
| Water Solubility: | miscible |
| Solubility: | Miscible with water |
| Appearance: | Light yellow liquid. |
| Specification: |
?Ethyl nicotinoate (CAS NO.614-18-6) should be stored in a cool and?a tightly closed container, can be?used in organic synthesis. |
| HS Code: | 29333999 |
| Color: | light yellow |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
