| Identification |
| Name: | 2-Propen-1-one,1,3-diphenyl-, (2E)- |
| Synonyms: | 2-Propen-1-one,1,3-diphenyl-, (E)-;Chalcone, (E)- (8CI);(2E)-1,3-Diphenyl-2-propen-1-one;(E)-1,3-Diphenyl-2-propen-1-one;(E)-1,3-Diphenylpropen-3-one;(E)-1,3-Diphenylpropenone;(E)-1-Benzoyl-2-phenylethylene;(E)-Benzalacetophenone;(E)-Benzylideneacetophenone;(E)-Chalcone;NSC 167107;Phenyl(E)-2-phenylethenyl ketone;Phenyl (E)-styryl ketone;Phenyl trans-styrylketone;trans-1,3-Diphenyl-2-propen-1-one;trans-1,3-Diphenylprop-1-en-3-one;trans-1,3-Diphenylpropen-3-one;trans-Benzalacetophenone;trans-Benzylideneacetophenone; |
| CAS: | 614-47-1 |
| EINECS: | 210-383-8 |
| Molecular Formula: | C15H12O |
| Molecular Weight: | 208.26 |
| InChI: | InChI=1/C15H12O/c16-15(14-9-5-2-6-10-14)12-11-13-7-3-1-4-8-13/h1-12H/b12-11+ |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.097 g/cm3 |
| Stability: | Stable at normal temperatures and pressures. |
| Refractive index: | 1.625 |
| Solubility: | Insoluble |
| Specification: |
(E)-Chalcone , its cas register number is 614-47-1. It also can be called 2-Propen-1-one,1,3-diphenyl-, (2E)- ; (E)-1,3-Diphenyl-2-propen-1-one ; (E)-Benzylideneacetophenone ; Phenyl (E)-2-phenylethenyl ketone ; Phenyl trans-styryl ketone ; trans-Benzalacetophenone ; trans-Benzylideneacetophenone ; trans-Chalcone .
|
| Storage Temperature: | Keep tightly closed. |
| Usage: | Open chain flavonoid that may prevent lung and forestomach cancer. |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |