| Identification | |
| Name: | cis-Resveratrol |
| Synonyms: | (Z)-3,5,4'-Trihydroxystilbene |
| CAS: | 61434-67-1 |
| Molecular Formula: | C14H12O3 |
| Molecular Weight: | 228.24 |
| InChI: | InChI=1/C14H12O3/c15-12-5-3-10(4-6-12)1-2-11-7-13(16)9-14(17)8-11/h1-9,15-17H/b2-1- |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 167-1700C (dec) |
| Flash Point: | 222.4°C |
| Boiling Point: | 449.1°C at 760 mmHg |
| Density: | 1.359g/cm3 |
| Refractive index: | 1.762 |
| Appearance: | Off-White Solid |
| Specification: |
The cis-Resveratrol with the CAS number 61434-67-1 is alos called (Z)-Resveratrol. Both the systematic name and IUPAC name are 5-[(Z)-2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol. Its molecular formula is C14H12O3. This chemical belongs to the following product categories: (1)Inhibitors; (2)Intermediates & Fine Chemicals; (3)Pharmaceuticals. The properties of the chemical are: (1)ACD/LogP: 3.14; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 3.14; (4)ACD/LogD (pH 7.4): 3.13; (5)ACD/BCF (pH 5.5): 143.19; (6)ACD/BCF (pH 7.4): 140.74; (7)ACD/KOC (pH 5.5): 1215.59; (8)ACD/KOC (pH 7.4): 1194.74; (9)#H bond acceptors: 3; (10)#H bond donors: 3; (11)#Freely Rotating Bonds: 5; (12)Polar Surface Area: 27.69 Å2; (13)Index of Refraction: 1.762; (14)Molar Refractivity: 69.29 cm3; (15)Molar Volume: 167.9 cm3; (16)Polarizability: 27.46×10-24cm3; (17)Surface Tension: 70.7 dyne/cm; (18)Enthalpy of Vaporization: 73.5 kJ/mol; (19)Vapour Pressure: 1.11×10-8 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Flash Point: | 222.4°C |
| Usage: | Minor constituent of wine, correlated with serum lipid reduction and inhibition of platelet aggregation. Resveratrol is a specific inhibitor of COX-1, and it also inhibits the hydroperoxidase activity of COX-1. It has been shown to inhibit events a |
| Safety Data | |
 |
|
