| Identification | |
| Name: | 1,2-Phenylenediamine dihydrochloride |
| Synonyms: | 1,2-Benzenediamine,dihydrochloride (9CI); o-Phenylenediamine, dihydrochloride (8CI);1,2-Diaminobenzene dihydrochloride; 1,2-Phenylenediamine dihydrochloride |
| CAS: | 615-28-1 |
| EINECS: | 210-418-7 |
| Molecular Formula: | C6H8 N2 . 2 Cl H |
| Molecular Weight: | 108.14112 |
| InChI: | InChI=1S/C6H8N2/c7-5-3-1-2-4-6(5)8/h1-4H,7-8H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 6.1/PG 3 |
| Melting Point: | 258 °C (dec.)(lit.) |
| Flash Point: | 124.9°C |
| Boiling Point: | 257°C at 760 mmHg |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Solubility: | FREELY SOL IN ALCOHOL, CHLOROFORM, ETHER SOL IN BENZENE In water, 4.07X10+4 mg/l at 35 deg C. |
| Specification: |
o-Phenylenediamine dihydrochloride ,its cas register number is 615-28-1. It also can be called p-Benzenediamine dihydrochloride ; m-Benzenediamine dihydrochloride ; Phenylenediamine dihydrochloride ;and 1,2-Benzenediamine, hydrochloride (1:2) . |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Flash Point: | 124.9°C |
| Storage Temperature: | 2-8°C |
| Color: | white to off-white |
| Safety Data | |
| Hazard Symbols | |
 |
|
