| Identification | |
| Name: | 2-Iodoaniline |
| Synonyms: | - |
| CAS: | 615-43-0 |
| EINECS: | 210-426-0 |
| Molecular Formula: | C6H6IN |
| Molecular Weight: | 219.02301 |
| InChI: | InChI=1S/C6H6IN/c7-5-3-1-2-4-6(5)8/h1-4H,8H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 |
| Density: | 1.924 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.688 |
| Water Solubility: | slightly soluble in Water |
| Solubility: | slightly soluble in Water |
| Appearance: | brown - yellow Needles |
| Specification: | YELLOW TO BROWN CRYSTALLINE NEEDLES Safety Statements:36/37-36/37/39-26-36 36/37:Wear suitable protective clothing and gloves 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Packinggroup: | III |
| HS Code: | 29214210 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Light Sensitive |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
