| Identification | |
| Name: | Pentanoic acid,2,4-dioxo-, ethyl ester |
| Synonyms: | Ethylacetylpyruvate;Ethyl acetopyruvate;Ethyl 2,4-dioxopentanoate;NSC 1243;NSC 97434;Valericacid, 2,4-dioxo-, ethyl ester (6CI,7CI,8CI);2,4-Dioxopentanoic acid ethylester;Ethoxalylacetone;Ethyl (acetylmethyl)glyoxylate; |
| CAS: | 615-79-2 |
| EINECS: | 210-447-5 |
| Molecular Formula: | C7H10O4 |
| Molecular Weight: | 158.15 |
| InChI: | InChI=1/C7H10O4/c1-3-11-7(10)6(9)4-5(2)8/h3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.126 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.473-1.475 |
| Solubility: | Very soluble |
| Appearance: | Clear very slight yellow liquid. |
| Specification: | clear yellow liquid Safety Statements:23-24/25-36-26 23:Do not breathe gas/fumes/vapor/spray (appropriate wording to be specified by the manufacturer) 24/25:Avoid contact with skin and eyes 36:Wear suitable protective clothing 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| HS Code: | 29183000 |
| Storage Temperature: | 2-8°C |
| Safety Data | |
 |
|
