| Identification | |
| Name: | 3-Amino-1,2-propanediol |
| Synonyms: | 1,2-Dihydroxy-3-aminopropane;1-Amino-2,3-dihydroxypropane;1-Amino-2,3-propanediol;1-Aminoglycerol;2,3-Dihydroxypropan-1-amine;2,3-Dihydroxypropanamine;3-Amino-1,2-dihydroxypropane;3-Amino-2-hydroxy-1-propanol;3-Amino-2-hydroxypropanol;Isoserinol;NSC 67381; |
| CAS: | 616-30-8 |
| EINECS: | 210-475-8 |
| Molecular Formula: | C3H9NO2 |
| Molecular Weight: | 91.11 |
| InChI: | InChI=1/C3H9NO2/c4-1-3(6)2-5/h3,5-6H,1-2,4H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2735 |
| Density: | 1.175 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.49-1.494 |
| Water Solubility: | soluble |
| Solubility: | Miscible (soluble in alcohol) |
| Appearance: | viscous clear liquid |
| Specification: |
?3-Amino-1,2-propanediol, its CAS NO. is 616-30-8, the synonyms are 1,2-Propanediol, 3-amino- ; 1-aminopropanediol ; 2,3-Dihydroxypropylamine ; 2,3-Propandiol-1-amine?; 3-amino-2-propanediol . |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| HS Code: | 29221980 |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Store protected from moisture. |
| Sensitive: | Hygroscopic |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
