| Identification |
| Name: | Sulfurous acid,dimethyl ester |
| Synonyms: | Methylsulfite (6CI,7CI); Dimethoxy sulfoxide; Dimethyl sulfite; NSC 41902 |
| CAS: | 616-42-2 |
| EINECS: | 210-481-0 |
| Molecular Formula: | C2H6 O3 S |
| Molecular Weight: | 110.13 |
| InChI: | InChI=1/C2H6O3S/c1-4-6(3)5-2/h1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 1993 |
| Density: | 1.294 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.4085-1.4105 |
| Water Solubility: | soluble |
| Solubility: | soluble in water |
| Appearance: | clear, colorless liquid |
| Packinggroup: | III |
| HS Code: | 29209085 |
| Storage Temperature: | Flammables area |
| Usage: | Used as an additive in some polymers to prevent oxidation. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
