| Identification | |
| Name: | D(+)-2-Octanol |
| Synonyms: | (S)-2-Octanol |
| CAS: | 6169-06-8 |
| EINECS: | 228-213-6 |
| Molecular Formula: | C8H18O |
| Molecular Weight: | 130.23 |
| InChI: | InChI=1S/C8H18O/c1-3-4-5-6-7-8(2)9/h8-9H,3-7H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | -38 |
| Flash Point: | 71 oC |
| Boiling Point: | 175 C |
| Density: | 0.822 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents |
| Refractive index: | 1.425-1.427 |
| Alpha: | 9.5 o (NEAT) |
| Water Solubility: | 1 G/L (20 oC) |
| Solubility: | 1 g/l |
| Appearance: | clear liquid |
| Packinggroup: | I; II; III |
| HS Code: | 29051620 |
| Flash Point: | 71 oC |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Color: | COLORLESS |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
