| Identification | |
| Name: | DL-Aspartic acid |
| Synonyms: | Asparticacid, DL- (8CI);617-45-8;(RS)-Aspartic acid;Aminosuccinicacid;DL-Aminosuccinic acid;NSC 141379;Aspartic Acid;DL-Asp-OH; |
| CAS: | 617-45-8 |
| EINECS: | 210-513-3 |
| Molecular Formula: | C4H7NO4 |
| Molecular Weight: | 133.1 |
| InChI: | InChI=1/C4H7NO4/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H,6,7)(H,8,9) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Density: | 1.514 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Water Solubility: | SOLUBLE |
| Solubility: | soluble |
| Appearance: | white powder |
| Specification: | White crystalline powder Safety Statements:22-24/25-36-26 22:Do not breathe dust 24/25:Avoid contact with skin and eyes 36:Wear suitable protective clothing 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| HS Code: | 29224995 |
| Storage Temperature: | Store at RT. |
| Color: | White, crystalline solid Orthorhombic bisphenoidal leaflets or rods |
| Usage: | Biologically significant amino acid. |
| Safety Data | |
| Hazard Symbols | |
 |
|
