| Identification | |
| Name: | 2-Chloro-p-phenylenediamine sulfate |
| Synonyms: | 2-Chloro-p-phenylenediamine sulphate; Chloropphenylenediaminesulfate; 2-Chloro-1,4-diaminobenzene sulphate; O-Chlono-p-phenylene diamine sulfate |
| CAS: | 61702-44-1 |
| EINECS: | 262-915-3 |
| Molecular Formula: | C6H7ClN2?H2SO4 |
| Molecular Weight: | 240.66 |
| InChI: | InChI=1/C6H7ClN2.H2O4S/c7-5-3-4(8)1-2-6(5)9;1-5(2,3)4/h1-3H,8-9H2;(H2,1,2,3,4) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 |
| Stability: | Stable. Incompatible with oxidizing agents, acids. |
| Solubility: | <0.1 g/100 mL at 21 ºC in water |
| Appearance: | white to off-white powder |
| Specification: |
2-Chloro-1,4-phenylenediamine sulfate (CAS NO.61702-44-1) is also named as 2-Chloro-1,4-benzenediamine sulfate (1:1) ; 2-Chloro-1,4-phenylenediamine sulfate (1:1) ; 2-Chloro-p-phenylenediamine sulfate ; CCRIS 145 ; 1,4-Benzenediamine, 2-chloro-, sulfate (1:1) . 2-Chloro-1,4-phenylenediamine sulfate (CAS NO.61702-44-1) is white to off-white powder. It is insoluble in water. 2-Chloro-1,4-phenylenediamine sulfate is an acidic salt of an amine. Flash point data for 2-Chloro-1,4-phenylenediamine sulfate are not available; however, it is probably combustible. |
| Packinggroup: | II |
| HS Code: | 29215119 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
