Identification |
Name: | 2-Furancarboxylic acid,5-chloro- |
Synonyms: | 2-Furoicacid, 5-chloro- (6CI,7CI,8CI); 5-Chloro-2-furoic acid;5-Chlorofuran-2-carboxylic acid; NSC 35572 |
CAS: | 618-30-4 |
Molecular Formula: | C5H3 Cl O3 |
Molecular Weight: | 146.53 |
InChI: | InChI=1/C5H3ClO3/c6-4-2-1-3(9-4)5(7)8/h1-2H,(H,7,8)/p-1 |
Molecular Structure: |
|
Properties |
Flash Point: | 103.1°C |
Boiling Point: | 246.8°C at 760 mmHg |
Specification: |
2-Furancarboxylic acid,5-chloro- , with CAS number of 618-30-4, can be called 5-Chlorofuran-2-carboxylic acid ; 5-chloro-2-furoic acid ; 5-chloropyromucic acid .
|
Flash Point: | 103.1°C |
Safety Data |
|
|