| Identification | |
| Name: | 2-Furancarboxylic acid,5-chloro- |
| Synonyms: | 2-Furoicacid, 5-chloro- (6CI,7CI,8CI); 5-Chloro-2-furoic acid;5-Chlorofuran-2-carboxylic acid; NSC 35572 |
| CAS: | 618-30-4 |
| Molecular Formula: | C5H3 Cl O3 |
| Molecular Weight: | 146.53 |
| InChI: | InChI=1/C5H3ClO3/c6-4-2-1-3(9-4)5(7)8/h1-2H,(H,7,8)/p-1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 103.1°C |
| Boiling Point: | 246.8°C at 760 mmHg |
| Specification: |
2-Furancarboxylic acid,5-chloro- , with CAS number of 618-30-4, can be called 5-Chlorofuran-2-carboxylic acid ; 5-chloro-2-furoic acid ; 5-chloropyromucic acid . |
| Flash Point: | 103.1°C |
| Safety Data | |
 |
|
