| Identification |
| Name: | Benzenemethanamine, a-methyl- |
| CAS: | 618-36-0 |
| EINECS: | 210-545-8 |
| Molecular Formula: | C8H11 N |
| Molecular Weight: | 121.18 |
| InChI: | InChI=1S/C8H11N/c1-7(9)8-5-3-2-4-6-8/h2-7H,9H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2735 |
| Melting Point: | -65 ºC |
| Flash Point: | 69 ºC |
| Boiling Point: | 188 ºC |
| Density: | 0.94 |
| Stability: | Stable, but absorbs carbon dioxide from the air. Store under an inert atmosphere. Incompatible with strong oxidizing agents, carbon dioxide. |
| Refractive index: | 1.525-1.527 |
| Water Solubility: | 4.2 G/100 ML (20 ºC) |
| Solubility: | 4.2 g/100 mL (20 ºC) |
| Appearance: | liquid |
| Packinggroup: | III |
| HS Code: | 29214980 |
| Flash Point: | 69 ºC |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Corrosives area. |
| Sensitive: | Air Sensitive |
| Color: | WATER-WHITE LIQ |
| Safety Data |
| Hazard Symbols |
C: Corrosive
|
| |
 |
