| Identification | |
| Name: | Benzoic acid,3,5-diamino-, hydrochloride (1:2) |
| Synonyms: | Benzoicacid, 3,5-diamino-, dihydrochloride (8CI,9CI); 3,5-Diaminobenzoic aciddihydrochloride |
| CAS: | 618-56-4 |
| EINECS: | 210-556-8 |
| Molecular Formula: | C7H8 N2 O2 . 2 Cl H |
| Molecular Weight: | 152.15062 |
| InChI: | InChI=1S/C7H8N2O2/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3H,8-9H2,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Water Solubility: | Solubility in water: 0.1 g/ml (20?C) |
| Solubility: | Solubility in water: 0.1 g/ml (20?C) |
| Appearance: | beige - grey - fine Crystalline powder |
| Specification: | BEIGE TO GREY FLUFFY FINE CRYSTALLINE POWDER Safety Statements:22-24/25 22:Do not breathe dust 24/25:Avoid contact with skin and eyes |
| Report: |
Reported in EPA TSCA Inventory. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
