| Identification |
| Name: | 3,5-dichloronitrobenzene |
| Synonyms: | 3,5-Dichloronitrobenzene~5-Nitro-m-dichlorobenzene |
| CAS: | 618-62-2 |
| EINECS: | 210-557-3 |
| Molecular Formula: | C6H3Cl2NO2 |
| Molecular Weight: | 192 |
| InChI: | InChI=1/C6H3Cl2NO2/c7-4-1-5(8)3-6(2-4)9(10)11/h1-3H |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN3077 |
| Density: | 1.533 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.595 |
| Water Solubility: | insoluble |
| Solubility: | insoluble in water |
| Appearance: | Orange to brown crystals |
| Packinggroup: | III |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
