| Identification | |
| Name: | Benzoic acid,3-amino-5-nitro- |
| Synonyms: | 3-Amino-5-nitrobenzoicacid; NSC 44297 |
| CAS: | 618-84-8 |
| EINECS: | -0 |
| Molecular Formula: | C7H6 N2 O4 |
| Molecular Weight: | 182.14 |
| InChI: | InChI=1/C7H6N2O4/c8-5-1-4(7(10)11)2-6(3-5)9(12)13/h1-3H,8H2,(H,10,11)/p-1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.568 g/cm3 |
| Specification: | Safety Statements:26-36/37/39-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 36:Wear suitable protective clothing |
| Safety Data | |
 |
|
