| Identification |
| Name: | 5-Nitroisophthalic acid |
| Synonyms: | 5-Nitrobenzene-1,3-dicarboxylic acid; 5-NIPA; 5-Nitro-1,3-benzenedicarboxylic acid; 5-Nitroisophthalic acid |
| CAS: | 618-88-2 |
| EINECS: | 210-568-3 |
| Molecular Formula: | C8H5NO6 |
| Molecular Weight: | 211.13 |
| InChI: | InChI=1/C8H5NO6/c10-7(11)4-1-5(8(12)13)3-6(2-4)9(14)15/h1-3H,(H,10,11)(H,12,13) |
| Molecular Structure: |
 |
| Properties |
| Transport: | 2811 |
| Flash Point: | 120ºC |
| Density: | 1.671 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Solubility: | Very soluble |
| Appearance: | Off White To Ivory Powder |
| Flash Point: | 120ºC |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
