| Identification |
| Name: | Benzoicacid, 4-ethyl- |
| Synonyms: | Benzoicacid, p-ethyl- (6CI,7CI,8CI);NSC 59888;p-Ethylbenzoicacid; |
| CAS: | 619-64-7 |
| EINECS: | 210-605-3 |
| Molecular Formula: | C9H10O2 |
| Molecular Weight: | 150.18 |
| InChI: | InChI=1/C9H10O2/c1-2-7-3-5-8(6-4-7)9(10)11/h3-6H,2H2,1H3,(H,10,11) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 125 |
| Boiling Point: | 270 |
| Density: | 0.9961 (20 C) |
| Stability: | Stable under normal temperatures and pressures. |
| Solubility: | Soluble |
| Appearance: | White to beige powder. |
| HS Code: | 29163900 |
| Flash Point: | 125 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | Intermediates of Liquid Crystals |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
